C20H17F3N4O5S — CID 32502846
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate (PubChem CID 32502846) has the molecular formula C20H17F3N4O5S and a molecular weight of 482.44 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 32502846 |
| Molecular Formula | C20H17F3N4O5S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H17F3N4O5S/c21-20(22,23)14-1-2-15(16(9-14)27(30)31)26-6-3-12(4-7-26)19(29)32-11-17(28)25-18-13(10-24)5-8-33-18/h1-2,5,8-9,12H,3-4,6-7,11H2,(H,25,28) |
| InChIKey | BCTSCSBFCKMHBF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|