C21H20N4O5 — CID 7835751
[2-(4-cyanoanilino)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 7835751) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7835751 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C21H20N4O5/c22-13-15-5-7-17(8-6-15)23-20(26)14-30-21(27)16-9-11-24(12-10-16)18-3-1-2-4-19(18)25(28)29/h1-8,16H,9-12,14H2,(H,23,26) |
| InChIKey | DFWSJNKFPMWHHQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|