C24H24N4O5S — CID 29313766
[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 29313766) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is [2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | [2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 29313766 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | Cc1nc(-c2cccc(NC(=O)COC(=O)C3CCN(c4ccccc4[N+](=O)[O-])CC3)c2)cs1 |
| InChI | InChI=1S/C24H24N4O5S/c1-16-25-20(15-34-16)18-5-4-6-19(13-18)26-23(29)14-33-24(30)17-9-11-27(12-10-17)21-7-2-3-8-22(21)28(31)32/h2-8,13,15,17H,9-12,14H2,1H3,(H,26,29) |
| InChIKey | LRNLAGLHCKJLSO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|