C11H10N2O3S — CID 3912539
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 3912539) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 3912539 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)C1CC1 |
| InChI | InChI=1S/C11H10N2O3S/c12-5-8-3-4-17-10(8)13-9(14)6-16-11(15)7-1-2-7/h3-4,7H,1-2,6H2,(H,13,14) |
| InChIKey | SOSBAUDVPHFVJU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |