C15H20N3O3S+ — CID 2540011
ethyl (3S)-1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 2540011) has the molecular formula C15H20N3O3S+ and a molecular weight of 322.41 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 2540011 |
| Molecular Formula | C15H20N3O3S+ |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | ethyl (3S)-1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](CC(=O)Nc2sccc2C#N)C1 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-21-15(20)12-4-3-6-18(9-12)10-13(19)17-14-11(8-16)5-7-22-14/h5,7,12H,2-4,6,9-10H2,1H3,(H,17,19)/p+1/t12-/m0/s1 |
| InChIKey | FWDOKFSSHFMHEN-LBPRGKRZSA-O |
| XLogP | 0.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |