C16H22FN2O3+ — CID 8533160
ethyl (3S)-1-[2-(3-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8533160) has the molecular formula C16H22FN2O3+ and a molecular weight of 309.36 g/mol. Its IUPAC name is ethyl (3S)-1-[2-(3-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-(3-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8533160 |
| Molecular Formula | C16H22FN2O3+ |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | ethyl (3S)-1-[2-(3-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](CC(=O)Nc2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H21FN2O3/c1-2-22-16(21)12-5-4-8-19(10-12)11-15(20)18-14-7-3-6-13(17)9-14/h3,6-7,9,12H,2,4-5,8,10-11H2,1H3,(H,18,20)/p+1/t12-/m0/s1 |
| InChIKey | TZYDIPURVOZJLB-LBPRGKRZSA-O |
| XLogP | 0.62 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |