C21H32N3O3+ — CID 8532692
ethyl (3S)-1-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8532692) has the molecular formula C21H32N3O3+ and a molecular weight of 374.51 g/mol. Its IUPAC name is ethyl (3S)-1-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8532692 |
| Molecular Formula | C21H32N3O3+ |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | ethyl (3S)-1-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](CC(=O)Nc2ccc(N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C21H31N3O3/c1-2-27-21(26)17-7-6-12-23(15-17)16-20(25)22-18-8-10-19(11-9-18)24-13-4-3-5-14-24/h8-11,17H,2-7,12-16H2,1H3,(H,22,25)/p+1/t17-/m0/s1 |
| InChIKey | PQHALZODCNFXJG-KRWDZBQOSA-O |
| XLogP | 1.47 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|