C18H27N2O4+ — CID 6952853
ethyl (3R)-1-[3-(4-methoxyanilino)-3-oxopropyl]piperidin-1-ium-3-carboxylate (PubChem CID 6952853) has the molecular formula C18H27N2O4+ and a molecular weight of 335.42 g/mol. Its IUPAC name is ethyl (3R)-1-[3-(4-methoxyanilino)-3-oxopropyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[3-(4-methoxyanilino)-3-oxopropyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6952853 |
| Molecular Formula | C18H27N2O4+ |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | ethyl (3R)-1-[3-(4-methoxyanilino)-3-oxopropyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](CCC(=O)Nc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-24-18(22)14-5-4-11-20(13-14)12-10-17(21)19-15-6-8-16(23-2)9-7-15/h6-9,14H,3-5,10-13H2,1-2H3,(H,19,21)/p+1/t14-/m1/s1 |
| InChIKey | BTFHUIJCWUJKTP-CQSZACIVSA-O |
| XLogP | 0.88 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |