C16H25N2O2+ — CID 4742378
N-(3-methoxyphenyl)-3-(3-methylpiperidin-1-ium-1-yl)propanamide (PubChem CID 4742378) has the molecular formula C16H25N2O2+ and a molecular weight of 277.39 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-3-(3-methylpiperidin-1-ium-1-yl)propanamide.
| Compound Name | N-(3-methoxyphenyl)-3-(3-methylpiperidin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 4742378 |
| Molecular Formula | C16H25N2O2+ |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-(3-methoxyphenyl)-3-(3-methylpiperidin-1-ium-1-yl)propanamide |
| SMILES | COc1cccc(NC(=O)CC[NH+]2CCCC(C)C2)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-13-5-4-9-18(12-13)10-8-16(19)17-14-6-3-7-15(11-14)20-2/h3,6-7,11,13H,4-5,8-10,12H2,1-2H3,(H,17,19)/p+1 |
| InChIKey | XTSGSHNPNOHSJD-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |