C15H22ClN2O+ — CID 6941455
N-(2-chlorophenyl)-3-[(3R)-3-methylpiperidin-1-ium-1-yl]propanamide (PubChem CID 6941455) has the molecular formula C15H22ClN2O+ and a molecular weight of 281.81 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-[(3R)-3-methylpiperidin-1-ium-1-yl]propanamide.
| Compound Name | N-(2-chlorophenyl)-3-[(3R)-3-methylpiperidin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 6941455 |
| Molecular Formula | C15H22ClN2O+ |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(2-chlorophenyl)-3-[(3R)-3-methylpiperidin-1-ium-1-yl]propanamide |
| SMILES | C[C@@H]1CCC[NH+](CCC(=O)Nc2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H21ClN2O/c1-12-5-4-9-18(11-12)10-8-15(19)17-14-7-3-2-6-13(14)16/h2-3,6-7,12H,4-5,8-11H2,1H3,(H,17,19)/p+1/t12-/m1/s1 |
| InChIKey | LJACRDNWPDYOBI-GFCCVEGCSA-O |
| XLogP | 1.98 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |