C16H21ClFN2O3+ — CID 8532536
ethyl (3S)-1-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8532536) has the molecular formula C16H21ClFN2O3+ and a molecular weight of 343.81 g/mol. Its IUPAC name is ethyl (3S)-1-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8532536 |
| Molecular Formula | C16H21ClFN2O3+ |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | ethyl (3S)-1-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](CC(=O)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H20ClFN2O3/c1-2-23-16(22)11-4-3-7-20(9-11)10-15(21)19-12-5-6-14(18)13(17)8-12/h5-6,8,11H,2-4,7,9-10H2,1H3,(H,19,21)/p+1/t11-/m0/s1 |
| InChIKey | QJPFQGSSUSBMDH-NSHDSACASA-O |
| XLogP | 1.28 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |