C14H18Cl2N3O2+ — CID 9305296
(3S)-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9305296) has the molecular formula C14H18Cl2N3O2+ and a molecular weight of 331.22 g/mol. Its IUPAC name is (3S)-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9305296 |
| Molecular Formula | C14H18Cl2N3O2+ |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (3S)-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[NH+](CC(=O)Nc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c15-11-4-3-10(6-12(11)16)18-13(20)8-19-5-1-2-9(7-19)14(17)21/h3-4,6,9H,1-2,5,7-8H2,(H2,17,21)(H,18,20)/p+1/t9-/m0/s1 |
| InChIKey | RRRYTMDBPFUIGG-VIFPVBQESA-O |
| XLogP | 0.71 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |