C14H18F2N3O2+ — CID 9305502
(3R)-1-[2-(2,6-difluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9305502) has the molecular formula C14H18F2N3O2+ and a molecular weight of 298.31 g/mol. Its IUPAC name is (3R)-1-[2-(2,6-difluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[2-(2,6-difluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9305502 |
| Molecular Formula | C14H18F2N3O2+ |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3R)-1-[2-(2,6-difluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[NH+](CC(=O)Nc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C14H17F2N3O2/c15-10-4-1-5-11(16)13(10)18-12(20)8-19-6-2-3-9(7-19)14(17)21/h1,4-5,9H,2-3,6-8H2,(H2,17,21)(H,18,20)/p+1/t9-/m1/s1 |
| InChIKey | QVUIYTYRRUPOKL-SECBINFHSA-O |
| XLogP | -0.32 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |