C15H20F2N3O2S+ — CID 9305267
(3R)-1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9305267) has the molecular formula C15H20F2N3O2S+ and a molecular weight of 344.41 g/mol. Its IUPAC name is (3R)-1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9305267 |
| Molecular Formula | C15H20F2N3O2S+ |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (3R)-1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[NH+](CC(=O)Nc2ccc(SC(F)F)cc2)C1 |
| InChI | InChI=1S/C15H19F2N3O2S/c16-15(17)23-12-5-3-11(4-6-12)19-13(21)9-20-7-1-2-10(8-20)14(18)22/h3-6,10,15H,1-2,7-9H2,(H2,18,22)(H,19,21)/p+1/t10-/m1/s1 |
| InChIKey | CMEANLBARPJAQK-SNVBAGLBSA-O |
| XLogP | 0.72 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |