C14H19FN3O2+ — CID 9305589
(3S)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9305589) has the molecular formula C14H19FN3O2+ and a molecular weight of 280.32 g/mol. Its IUPAC name is (3S)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9305589 |
| Molecular Formula | C14H19FN3O2+ |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3S)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[NH+](CC(=O)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H18FN3O2/c15-11-3-5-12(6-4-11)17-13(19)9-18-7-1-2-10(8-18)14(16)20/h3-6,10H,1-2,7-9H2,(H2,16,20)(H,17,19)/p+1/t10-/m0/s1 |
| InChIKey | LQFYWUXLNSMKJK-JTQLQIEISA-O |
| XLogP | -0.46 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |