C20H29N4O3+ — CID 9305182
(3R)-1-[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9305182) has the molecular formula C20H29N4O3+ and a molecular weight of 373.48 g/mol. Its IUPAC name is (3R)-1-[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9305182 |
| Molecular Formula | C20H29N4O3+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (3R)-1-[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[NH+](CC(=O)Nc2ccccc2C(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C20H28N4O3/c21-19(26)14-6-5-11-24(12-14)13-18(25)23-17-10-4-3-9-16(17)20(27)22-15-7-1-2-8-15/h3-4,9-10,14-15H,1-2,5-8,11-13H2,(H2,21,26)(H,22,27)(H,23,25)/p+1/t14-/m1/s1 |
| InChIKey | XYKABFSVGLEWRQ-CQSZACIVSA-O |
| XLogP | 0.08 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |