C16H24N3O4+ — CID 9305747
(3R)-1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9305747) has the molecular formula C16H24N3O4+ and a molecular weight of 322.39 g/mol. Its IUPAC name is (3R)-1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9305747 |
| Molecular Formula | C16H24N3O4+ |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (3R)-1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C[NH+]2CCC[C@@H](C(N)=O)C2)cc1OC |
| InChI | InChI=1S/C16H23N3O4/c1-22-13-6-5-12(8-14(13)23-2)18-15(20)10-19-7-3-4-11(9-19)16(17)21/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H2,17,21)(H,18,20)/p+1/t11-/m1/s1 |
| InChIKey | GRYWFWKTBYKOMZ-LLVKDONJSA-O |
| XLogP | -0.58 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |