C21H24N3O4+ — CID 9306036
(3R)-1-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9306036) has the molecular formula C21H24N3O4+ and a molecular weight of 382.44 g/mol. Its IUPAC name is (3R)-1-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9306036 |
| Molecular Formula | C21H24N3O4+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (3R)-1-[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)C[NH+]1CCC[C@@H](C(N)=O)C1)oc1ccccc12 |
| InChI | InChI=1S/C21H23N3O4/c1-27-19-9-15-14-6-2-3-7-17(14)28-18(15)10-16(19)23-20(25)12-24-8-4-5-13(11-24)21(22)26/h2-3,6-7,9-10,13H,4-5,8,11-12H2,1H3,(H2,22,26)(H,23,25)/p+1/t13-/m1/s1 |
| InChIKey | ASLHJLRTORZHOP-CYBMUJFWSA-O |
| XLogP | 1.31 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |