C15H21ClN3O2+ — CID 9306029
(3S)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9306029) has the molecular formula C15H21ClN3O2+ and a molecular weight of 310.81 g/mol. Its IUPAC name is (3S)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9306029 |
| Molecular Formula | C15H21ClN3O2+ |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (3S)-1-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[NH+](CC(=O)NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H20ClN3O2/c16-13-5-1-3-11(7-13)8-18-14(20)10-19-6-2-4-12(9-19)15(17)21/h1,3,5,7,12H,2,4,6,8-10H2,(H2,17,21)(H,18,20)/p+1/t12-/m0/s1 |
| InChIKey | XIEXCFWAIDZTCV-LBPRGKRZSA-O |
| XLogP | -0.26 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |