C13H19ClN3O+ — CID 7021368
(3S)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-carbohydrazide (PubChem CID 7021368) has the molecular formula C13H19ClN3O+ and a molecular weight of 268.77 g/mol. Its IUPAC name is (3S)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-carbohydrazide.
| Compound Name | (3S)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-carbohydrazide |
|---|---|
| PubChem CID | 7021368 |
| Molecular Formula | C13H19ClN3O+ |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3S)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-carbohydrazide |
| SMILES | NNC(=O)[C@H]1CCC[NH+](Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C13H18ClN3O/c14-12-5-1-3-10(7-12)8-17-6-2-4-11(9-17)13(18)16-15/h1,3,5,7,11H,2,4,6,8-9,15H2,(H,16,18)/p+1/t11-/m0/s1 |
| InChIKey | PVGIRPPTPCFWKJ-NSHDSACASA-O |
| XLogP | 0.12 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|