C14H22ClN3O+2 — CID 9258359
(2S)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propanamide (PubChem CID 9258359) has the molecular formula C14H22ClN3O+2 and a molecular weight of 283.80 g/mol. Its IUPAC name is (2S)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propanamide.
| Compound Name | (2S)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propanamide |
|---|---|
| PubChem CID | 9258359 |
| Molecular Formula | C14H22ClN3O+2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (2S)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]propanamide |
| SMILES | C[C@@H](C(N)=O)[NH+]1CC[NH+](Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H20ClN3O/c1-11(14(16)19)18-7-5-17(6-8-18)10-12-3-2-4-13(15)9-12/h2-4,9,11H,5-8,10H2,1H3,(H2,16,19)/p+2/t11-/m0/s1 |
| InChIKey | LIPRGBUJSXKVKT-NSHDSACASA-P |
| XLogP | -1.50 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |