C20H23ClF3N3O+2 — CID 9258411
(2R)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 9258411) has the molecular formula C20H23ClF3N3O+2 and a molecular weight of 413.87 g/mol. Its IUPAC name is (2R)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 9258411 |
| Molecular Formula | C20H23ClF3N3O+2 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (2R)-2-[4-[(3-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)c(F)c1F)[NH+]1CC[NH+](Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H21ClF3N3O/c1-13(20(28)25-17-6-5-16(22)18(23)19(17)24)27-9-7-26(8-10-27)12-14-3-2-4-15(21)11-14/h2-6,11,13H,7-10,12H2,1H3,(H,25,28)/p+2/t13-/m1/s1 |
| InChIKey | QJKXJPVYLCOXKZ-CYBMUJFWSA-P |
| XLogP | 1.07 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|