C16H22F3N2O+ — CID 2655375
(2S)-2-(azocan-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 2655375) has the molecular formula C16H22F3N2O+ and a molecular weight of 315.36 g/mol. Its IUPAC name is (2S)-2-(azocan-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-(azocan-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 2655375 |
| Molecular Formula | C16H22F3N2O+ |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (2S)-2-(azocan-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(F)c(F)c1F)[NH+]1CCCCCCC1 |
| InChI | InChI=1S/C16H21F3N2O/c1-11(21-9-5-3-2-4-6-10-21)16(22)20-13-8-7-12(17)14(18)15(13)19/h7-8,11H,2-6,9-10H2,1H3,(H,20,22)/p+1/t11-/m0/s1 |
| InChIKey | LCDIEGJHVWCISU-NSHDSACASA-O |
| XLogP | 2.28 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|