C13H15F3N3O2+ — CID 2467491
(2R)-2-(3-oxopiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 2467491) has the molecular formula C13H15F3N3O2+ and a molecular weight of 302.28 g/mol. Its IUPAC name is (2R)-2-(3-oxopiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-(3-oxopiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 2467491 |
| Molecular Formula | C13H15F3N3O2+ |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2R)-2-(3-oxopiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)c(F)c1F)[NH+]1CCNC(=O)C1 |
| InChI | InChI=1S/C13H14F3N3O2/c1-7(19-5-4-17-10(20)6-19)13(21)18-9-3-2-8(14)11(15)12(9)16/h2-3,7H,4-6H2,1H3,(H,17,20)(H,18,21)/p+1/t7-/m1/s1 |
| InChIKey | SNYUKMMZCQSXHR-SSDOTTSWSA-O |
| XLogP | -0.55 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|