C15H19F3N3O2+ — CID 9304819
(3S)-1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]piperidin-1-ium-3-carboxamide (PubChem CID 9304819) has the molecular formula C15H19F3N3O2+ and a molecular weight of 330.33 g/mol. Its IUPAC name is (3S)-1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9304819 |
| Molecular Formula | C15H19F3N3O2+ |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (3S)-1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]piperidin-1-ium-3-carboxamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)c(F)c1F)[NH+]1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C15H18F3N3O2/c1-8(21-6-2-3-9(7-21)14(19)22)15(23)20-11-5-4-10(16)12(17)13(11)18/h4-5,8-9H,2-3,6-7H2,1H3,(H2,19,22)(H,20,23)/p+1/t8-,9+/m1/s1 |
| InChIKey | ZHHWIQYBAKBOLU-BDAKNGLRSA-O |
| XLogP | 0.21 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|