C15H28N3O2+ — CID 8543235
(3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide (PubChem CID 8543235) has the molecular formula C15H28N3O2+ and a molecular weight of 282.41 g/mol. Its IUPAC name is (3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8543235 |
| Molecular Formula | C15H28N3O2+ |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide |
| SMILES | C[C@H](C(=O)NC1CCCCC1)[NH+]1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C15H27N3O2/c1-11(15(20)17-13-7-3-2-4-8-13)18-9-5-6-12(10-18)14(16)19/h11-13H,2-10H2,1H3,(H2,16,19)(H,17,20)/p+1/t11-,12+/m1/s1 |
| InChIKey | HUWHTURYGAOKDA-NEPJUHHUSA-O |
| XLogP | -0.40 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |