C17H26N3O2+ — CID 9348552
(2S)-2-(3-oxopiperazin-1-ium-1-yl)-N-[(1R)-1-phenylbutyl]propanamide (PubChem CID 9348552) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is (2S)-2-(3-oxopiperazin-1-ium-1-yl)-N-[(1R)-1-phenylbutyl]propanamide.
| Compound Name | (2S)-2-(3-oxopiperazin-1-ium-1-yl)-N-[(1R)-1-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 9348552 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2S)-2-(3-oxopiperazin-1-ium-1-yl)-N-[(1R)-1-phenylbutyl]propanamide |
| SMILES | CCC[C@@H](NC(=O)[C@H](C)[NH+]1CCNC(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-7-15(14-8-5-4-6-9-14)19-17(22)13(2)20-11-10-18-16(21)12-20/h4-6,8-9,13,15H,3,7,10-12H2,1-2H3,(H,18,21)(H,19,22)/p+1/t13-,15+/m0/s1 |
| InChIKey | RJRDIXNAHSBFDC-DZGCQCFKSA-O |
| XLogP | 0.05 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |