C21H30N5O+ — CID 9346900
(2S)-N-[(1R)-1-phenylbutyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide (PubChem CID 9346900) has the molecular formula C21H30N5O+ and a molecular weight of 368.50 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-phenylbutyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-[(1R)-1-phenylbutyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 9346900 |
| Molecular Formula | C21H30N5O+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2S)-N-[(1R)-1-phenylbutyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide |
| SMILES | CCC[C@@H](NC(=O)[C@H](C)[NH+]1CCN(c2ncccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H29N5O/c1-3-8-19(18-9-5-4-6-10-18)24-20(27)17(2)25-13-15-26(16-14-25)21-22-11-7-12-23-21/h4-7,9-12,17,19H,3,8,13-16H2,1-2H3,(H,24,27)/p+1/t17-,19+/m0/s1 |
| InChIKey | AGAICVPSVBHETF-PKOBYXMFSA-O |
| XLogP | 1.23 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |