C15H20N3O2+ — CID 9042971
(2R)-N-cyclopropyl-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide (PubChem CID 9042971) has the molecular formula C15H20N3O2+ and a molecular weight of 274.34 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide.
| Compound Name | (2R)-N-cyclopropyl-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 9042971 |
| Molecular Formula | C15H20N3O2+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2R)-N-cyclopropyl-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide |
| SMILES | O=C1C[NH+]([C@@H](C(=O)NC2CC2)c2ccccc2)CCN1 |
| InChI | InChI=1S/C15H19N3O2/c19-13-10-18(9-8-16-13)14(11-4-2-1-3-5-11)15(20)17-12-6-7-12/h1-5,12,14H,6-10H2,(H,16,19)(H,17,20)/p+1/t14-/m1/s1 |
| InChIKey | FNIUCGZWNQEKAY-CQSZACIVSA-O |
| XLogP | -0.98 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |