C17H24ClN2O+ — CID 4173138
2-(4-chlorophenyl)-N-cyclopentyl-2-pyrrolidin-1-ium-1-ylacetamide (PubChem CID 4173138) has the molecular formula C17H24ClN2O+ and a molecular weight of 307.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-cyclopentyl-2-pyrrolidin-1-ium-1-ylacetamide.
| Compound Name | 2-(4-chlorophenyl)-N-cyclopentyl-2-pyrrolidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 4173138 |
| Molecular Formula | C17H24ClN2O+ |
| Molecular Weight | 307.84 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-(4-chlorophenyl)-N-cyclopentyl-2-pyrrolidin-1-ium-1-ylacetamide |
| SMILES | O=C(NC1CCCC1)C(c1ccc(Cl)cc1)[NH+]1CCCC1 |
| InChI | InChI=1S/C17H23ClN2O/c18-14-9-7-13(8-10-14)16(20-11-3-4-12-20)17(21)19-15-5-1-2-6-15/h7-10,15-16H,1-6,11-12H2,(H,19,21)/p+1 |
| InChIKey | ZOANNWJCJCKKQO-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |