C22H30Cl2N2O2 — CID 3441709
2-[(2-chloroacetyl)-cyclohexylamino]-2-(4-chlorophenyl)-N-cyclohexylacetamide (PubChem CID 3441709) has the molecular formula C22H30Cl2N2O2 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-cyclohexylamino]-2-(4-chlorophenyl)-N-cyclohexylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-cyclohexylamino]-2-(4-chlorophenyl)-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 3441709 |
| Molecular Formula | C22H30Cl2N2O2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[(2-chloroacetyl)-cyclohexylamino]-2-(4-chlorophenyl)-N-cyclohexylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccc(Cl)cc1)N(C(=O)CCl)C1CCCCC1 |
| InChI | InChI=1S/C22H30Cl2N2O2/c23-15-20(27)26(19-9-5-2-6-10-19)21(16-11-13-17(24)14-12-16)22(28)25-18-7-3-1-4-8-18/h11-14,18-19,21H,1-10,15H2,(H,25,28) |
| InChIKey | KRDMRVNJMPLJIQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|