C23H25Cl3N2O2 — CID 86810132
2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-cyclopentylacetamide (PubChem CID 86810132) has the molecular formula C23H25Cl3N2O2 and a molecular weight of 467.82 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-cyclopentylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 86810132 |
| Molecular Formula | C23H25Cl3N2O2 |
| Molecular Weight | 467.82 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-cyclopentylacetamide |
| SMILES | O=C(NC1CCCC1)C(c1ccc(Cl)cc1)N(CCc1ccc(Cl)cc1)C(=O)CCl |
| InChI | InChI=1S/C23H25Cl3N2O2/c24-15-21(29)28(14-13-16-5-9-18(25)10-6-16)22(17-7-11-19(26)12-8-17)23(30)27-20-3-1-2-4-20/h5-12,20,22H,1-4,13-15H2,(H,27,30) |
| InChIKey | KRMWBCIRMGNKFT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|