C23H27Cl2N3O2 — CID 162533663
2-[(2-chloroacetyl)-[2-(3-chlorophenyl)ethyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide (PubChem CID 162533663) has the molecular formula C23H27Cl2N3O2 and a molecular weight of 448.39 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(3-chlorophenyl)ethyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(3-chlorophenyl)ethyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 162533663 |
| Molecular Formula | C23H27Cl2N3O2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(3-chlorophenyl)ethyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1cccnc1)N(CCc1cccc(Cl)c1)C(=O)CCl |
| InChI | InChI=1S/C23H27Cl2N3O2/c24-15-21(29)28(13-11-17-6-4-8-19(25)14-17)22(18-7-5-12-26-16-18)23(30)27-20-9-2-1-3-10-20/h4-8,12,14,16,20,22H,1-3,9-11,13,15H2,(H,27,30) |
| InChIKey | DNQFCIWJUBHKGQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|