C26H32BrClN2O4 — CID 98364369
(2S)-2-(3-bromophenyl)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexylacetamide (PubChem CID 98364369) has the molecular formula C26H32BrClN2O4 and a molecular weight of 551.91 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexylacetamide.
| Compound Name | (2S)-2-(3-bromophenyl)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 98364369 |
| Molecular Formula | C26H32BrClN2O4 |
| Molecular Weight | 551.91 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexylacetamide |
| SMILES | COc1ccc(CCN(C(=O)CCl)[C@H](C(=O)NC2CCCCC2)c2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C26H32BrClN2O4/c1-33-22-12-11-18(15-23(22)34-2)13-14-30(24(31)17-28)25(19-7-6-8-20(27)16-19)26(32)29-21-9-4-3-5-10-21/h6-8,11-12,15-16,21,25H,3-5,9-10,13-14,17H2,1-2H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | JWWMPTDCZICOQE-VWLOTQADSA-N |
| XLogP | 5.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|