C27H39ClN2O4 — CID 86809934
2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cyclohexyl-2-(4-ethoxy-3-methoxyphenyl)acetamide (PubChem CID 86809934) has the molecular formula C27H39ClN2O4 and a molecular weight of 491.07 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cyclohexyl-2-(4-ethoxy-3-methoxyphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cyclohexyl-2-(4-ethoxy-3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86809934 |
| Molecular Formula | C27H39ClN2O4 |
| Molecular Weight | 491.07 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cyclohexyl-2-(4-ethoxy-3-methoxyphenyl)acetamide |
| SMILES | CCOc1ccc(C(C(=O)NC2CCCCC2)N(CCC2=CCCCC2)C(=O)CCl)cc1OC |
| InChI | InChI=1S/C27H39ClN2O4/c1-3-34-23-15-14-21(18-24(23)33-2)26(27(32)29-22-12-8-5-9-13-22)30(25(31)19-28)17-16-20-10-6-4-7-11-20/h10,14-15,18,22,26H,3-9,11-13,16-17,19H2,1-2H3,(H,29,32) |
| InChIKey | OSKCLHKGALJJBS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|