C29H39ClN2O4 — CID 86810008
2-[(2-chloroacetyl)-(2-phenylethyl)amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 86810008) has the molecular formula C29H39ClN2O4 and a molecular weight of 515.09 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 86810008 |
| Molecular Formula | C29H39ClN2O4 |
| Molecular Weight | 515.09 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | CCCOc1ccc(C(C(=O)NC2CCC(C)CC2)N(CCc2ccccc2)C(=O)CCl)cc1OC |
| InChI | InChI=1S/C29H39ClN2O4/c1-4-18-36-25-15-12-23(19-26(25)35-3)28(29(34)31-24-13-10-21(2)11-14-24)32(27(33)20-30)17-16-22-8-6-5-7-9-22/h5-9,12,15,19,21,24,28H,4,10-11,13-14,16-18,20H2,1-3H3,(H,31,34) |
| InChIKey | QMKNCJMHSFUNTJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.09 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|