C28H36ClFN2O4 — CID 86809966
2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 86809966) has the molecular formula C28H36ClFN2O4 and a molecular weight of 519.06 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 86809966 |
| Molecular Formula | C28H36ClFN2O4 |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(3-methoxy-4-propoxyphenyl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | CCCOc1ccc(C(C(=O)NC2CCC(C)CC2)N(Cc2ccc(F)cc2)C(=O)CCl)cc1OC |
| InChI | InChI=1S/C28H36ClFN2O4/c1-4-15-36-24-14-9-21(16-25(24)35-3)27(28(34)31-23-12-5-19(2)6-13-23)32(26(33)17-29)18-20-7-10-22(30)11-8-20/h7-11,14,16,19,23,27H,4-6,12-13,15,17-18H2,1-3H3,(H,31,34) |
| InChIKey | MDWUMWTWPYXOBE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|