C26H33ClN2O2 — CID 3486904
2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide (PubChem CID 3486904) has the molecular formula C26H33ClN2O2 and a molecular weight of 441.02 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3486904 |
| Molecular Formula | C26H33ClN2O2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CN(C(=O)CCl)C(C(=O)NC2CCC(C)CC2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H33ClN2O2/c1-18-4-10-21(11-5-18)17-29(24(30)16-27)25(22-12-6-19(2)7-13-22)26(31)28-23-14-8-20(3)9-15-23/h4-7,10-13,20,23,25H,8-9,14-17H2,1-3H3,(H,28,31) |
| InChIKey | PJYVVGKSIBFSJW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|