C26H32ClFN2O4 — CID 86809989
2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(2,5-dimethoxyphenyl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 86809989) has the molecular formula C26H32ClFN2O4 and a molecular weight of 491.00 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(2,5-dimethoxyphenyl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(2,5-dimethoxyphenyl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 86809989 |
| Molecular Formula | C26H32ClFN2O4 |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(4-fluorophenyl)methyl]amino]-2-(2,5-dimethoxyphenyl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | COc1ccc(OC)c(C(C(=O)NC2CCC(C)CC2)N(Cc2ccc(F)cc2)C(=O)CCl)c1 |
| InChI | InChI=1S/C26H32ClFN2O4/c1-17-4-10-20(11-5-17)29-26(32)25(22-14-21(33-2)12-13-23(22)34-3)30(24(31)15-27)16-18-6-8-19(28)9-7-18/h6-9,12-14,17,20,25H,4-5,10-11,15-16H2,1-3H3,(H,29,32) |
| InChIKey | GDVFERDKKAFTQO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|