C25H30Cl2N2O3 — CID 86809977
2-[(2-chloroacetyl)-[(3-methoxyphenyl)methyl]amino]-2-(4-chlorophenyl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 86809977) has the molecular formula C25H30Cl2N2O3 and a molecular weight of 477.43 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(3-methoxyphenyl)methyl]amino]-2-(4-chlorophenyl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(3-methoxyphenyl)methyl]amino]-2-(4-chlorophenyl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 86809977 |
| Molecular Formula | C25H30Cl2N2O3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(3-methoxyphenyl)methyl]amino]-2-(4-chlorophenyl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | COc1cccc(CN(C(=O)CCl)C(C(=O)NC2CCC(C)CC2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H30Cl2N2O3/c1-17-6-12-21(13-7-17)28-25(31)24(19-8-10-20(27)11-9-19)29(23(30)15-26)16-18-4-3-5-22(14-18)32-2/h3-5,8-11,14,17,21,24H,6-7,12-13,15-16H2,1-2H3,(H,28,31) |
| InChIKey | SVNLEUMQOGBYNK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|