C25H31ClN2O2 — CID 4086572
2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide (PubChem CID 4086572) has the molecular formula C25H31ClN2O2 and a molecular weight of 426.99 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4086572 |
| Molecular Formula | C25H31ClN2O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(4-methylphenyl)methyl]amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccc(CN(C(=O)CCl)C(C(=O)NC2CCCCC2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C25H31ClN2O2/c1-18-12-14-20(15-13-18)17-28(23(29)16-26)24(22-11-7-6-8-19(22)2)25(30)27-21-9-4-3-5-10-21/h6-8,11-15,21,24H,3-5,9-10,16-17H2,1-2H3,(H,27,30) |
| InChIKey | JOZKNOKRNNMWHZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|