C24H28Cl2N2O2 — CID 86809828
2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide (PubChem CID 86809828) has the molecular formula C24H28Cl2N2O2 and a molecular weight of 447.41 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86809828 |
| Molecular Formula | C24H28Cl2N2O2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCCCC2)N(Cc2ccc(Cl)cc2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C24H28Cl2N2O2/c1-17-7-11-19(12-8-17)23(24(30)27-21-5-3-2-4-6-21)28(22(29)15-25)16-18-9-13-20(26)14-10-18/h7-14,21,23H,2-6,15-16H2,1H3,(H,27,30) |
| InChIKey | MKQNKYYLLHIITP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|