C26H37ClN2O2 — CID 86810056
2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cycloheptyl-2-(4-methylphenyl)acetamide (PubChem CID 86810056) has the molecular formula C26H37ClN2O2 and a molecular weight of 445.05 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cycloheptyl-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cycloheptyl-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86810056 |
| Molecular Formula | C26H37ClN2O2 |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(cyclohexen-1-yl)ethyl]amino]-N-cycloheptyl-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCCCCC2)N(CCC2=CCCCC2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C26H37ClN2O2/c1-20-13-15-22(16-14-20)25(26(31)28-23-11-7-2-3-8-12-23)29(24(30)19-27)18-17-21-9-5-4-6-10-21/h9,13-16,23,25H,2-8,10-12,17-19H2,1H3,(H,28,31) |
| InChIKey | RYMXERVZPFDUKO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|