C27H35N3O2S — CID 3191154
2-[2-(cyclohexen-1-yl)ethyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-2-ylacetamide (PubChem CID 3191154) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-2-ylacetamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 3191154 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-2-ylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccccn1)N(CCC1=CCCCC1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C27H35N3O2S/c31-25(20-23-14-9-19-33-23)30(18-16-21-10-3-1-4-11-21)26(24-15-7-8-17-28-24)27(32)29-22-12-5-2-6-13-22/h7-10,14-15,17,19,22,26H,1-6,11-13,16,18,20H2,(H,29,32) |
| InChIKey | REPVPWXJBQSJQY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|