C25H26FN3O2S — CID 25310452
(2R)-N-cyclohexyl-2-(4-fluoro-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-2-ylacetamide (PubChem CID 25310452) has the molecular formula C25H26FN3O2S and a molecular weight of 451.57 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-(4-fluoro-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-2-ylacetamide.
| Compound Name | (2R)-N-cyclohexyl-2-(4-fluoro-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 25310452 |
| Molecular Formula | C25H26FN3O2S |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (2R)-N-cyclohexyl-2-(4-fluoro-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-2-ylacetamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](c1ccccn1)N(C(=O)Cc1cccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FN3O2S/c26-18-11-13-20(14-12-18)29(23(30)17-21-9-6-16-32-21)24(22-10-4-5-15-27-22)25(31)28-19-7-2-1-3-8-19/h4-6,9-16,19,24H,1-3,7-8,17H2,(H,28,31)/t24-/m1/s1 |
| InChIKey | BCSGSAFLCUUYFE-XMMPIXPASA-N |
| XLogP | 5.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |