C24H24ClN3O2S — CID 1436017
(2S)-2-(4-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-pyridin-4-ylacetamide (PubChem CID 1436017) has the molecular formula C24H24ClN3O2S and a molecular weight of 454.00 g/mol. Its IUPAC name is (2S)-2-(4-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-pyridin-4-ylacetamide.
| Compound Name | (2S)-2-(4-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 1436017 |
| Molecular Formula | C24H24ClN3O2S |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (2S)-2-(4-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-pyridin-4-ylacetamide |
| SMILES | O=C(NC1CCCC1)[C@H](c1ccncc1)N(C(=O)Cc1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3O2S/c25-18-7-9-20(10-8-18)28(22(29)16-21-6-3-15-31-21)23(17-11-13-26-14-12-17)24(30)27-19-4-1-2-5-19/h3,6-15,19,23H,1-2,4-5,16H2,(H,27,30)/t23-/m0/s1 |
| InChIKey | KIXMSIJZLKVJKE-QHCPKHFHSA-N |
| XLogP | 5.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |