C27H31N3O3S — CID 3191129
N-cyclohexyl-2-(4-ethoxy-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-3-ylacetamide (PubChem CID 3191129) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-ethoxy-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-3-ylacetamide.
| Compound Name | N-cyclohexyl-2-(4-ethoxy-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 3191129 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-cyclohexyl-2-(4-ethoxy-N-(2-thiophen-2-ylacetyl)anilino)-2-pyridin-3-ylacetamide |
| SMILES | CCOc1ccc(N(C(=O)Cc2cccs2)C(C(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C27H31N3O3S/c1-2-33-23-14-12-22(13-15-23)30(25(31)18-24-11-7-17-34-24)26(20-8-6-16-28-19-20)27(32)29-21-9-4-3-5-10-21/h6-8,11-17,19,21,26H,2-5,9-10,18H2,1H3,(H,29,32) |
| InChIKey | GLYKSVSEHZVLGF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |