C26H28N2O3S — CID 3202719
N-cyclopentyl-2-(3-methoxyphenyl)-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 3202719) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-cyclopentyl-2-(3-methoxyphenyl)-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | N-cyclopentyl-2-(3-methoxyphenyl)-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 3202719 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-cyclopentyl-2-(3-methoxyphenyl)-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | COc1cccc(C(C(=O)NC2CCCC2)N(C(=O)Cc2cccs2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O3S/c1-31-22-14-7-9-19(17-22)25(26(30)27-20-10-5-6-11-20)28(21-12-3-2-4-13-21)24(29)18-23-15-8-16-32-23/h2-4,7-9,12-17,20,25H,5-6,10-11,18H2,1H3,(H,27,30) |
| InChIKey | AJOZMHFKSTYTKY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |