C23H28N2O3S — CID 3202678
N-cyclopentyl-2-[cyclopropyl-(2-thiophen-2-ylacetyl)amino]-2-(3-methoxyphenyl)acetamide (PubChem CID 3202678) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-cyclopentyl-2-[cyclopropyl-(2-thiophen-2-ylacetyl)amino]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-cyclopentyl-2-[cyclopropyl-(2-thiophen-2-ylacetyl)amino]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3202678 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-cyclopentyl-2-[cyclopropyl-(2-thiophen-2-ylacetyl)amino]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(C(C(=O)NC2CCCC2)N(C(=O)Cc2cccs2)C2CC2)c1 |
| InChI | InChI=1S/C23H28N2O3S/c1-28-19-9-4-6-16(14-19)22(23(27)24-17-7-2-3-8-17)25(18-11-12-18)21(26)15-20-10-5-13-29-20/h4-6,9-10,13-14,17-18,22H,2-3,7-8,11-12,15H2,1H3,(H,24,27) |
| InChIKey | KLZKKRIDZAKGJP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |