C27H30N2O3S — CID 3202922
N-cyclopentyl-2-[(3-methoxyphenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide (PubChem CID 3202922) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-cyclopentyl-2-[(3-methoxyphenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide.
| Compound Name | N-cyclopentyl-2-[(3-methoxyphenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 3202922 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-cyclopentyl-2-[(3-methoxyphenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide |
| SMILES | COc1cccc(CN(C(=O)Cc2cccs2)C(C(=O)NC2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H30N2O3S/c1-32-23-14-7-9-20(17-23)19-29(25(30)18-24-15-8-16-33-24)26(21-10-3-2-4-11-21)27(31)28-22-12-5-6-13-22/h2-4,7-11,14-17,22,26H,5-6,12-13,18-19H2,1H3,(H,28,31) |
| InChIKey | OXQFDFYVKNRQMV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |